C18H18BNO4 — CID 154702467
6-methyl-2-[4-(3-methylphenyl)phenyl]-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 154702467) has the molecular formula C18H18BNO4 and a molecular weight of 323.16 g/mol. Its IUPAC name is 6-methyl-2-[4-(3-methylphenyl)phenyl]-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 6-methyl-2-[4-(3-methylphenyl)phenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 154702467 |
| Molecular Formula | C18H18BNO4 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 6-methyl-2-[4-(3-methylphenyl)phenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | Cc1cccc(-c2ccc(B3OC(=O)CN(C)CC(=O)O3)cc2)c1 |
| InChI | InChI=1S/C18H18BNO4/c1-13-4-3-5-15(10-13)14-6-8-16(9-7-14)19-23-17(21)11-20(2)12-18(22)24-19/h3-10H,11-12H2,1-2H3 |
| InChIKey | SVPSLNVHUBBCIE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|