C8H16N2O6 — CID 154702648
N-[(2R,3R,4R,5S,6S)-6-[(R)-amino(hydroxy)methyl]-2,4,5-trihydroxyoxan-3-yl]acetamide (PubChem CID 154702648) has the molecular formula C8H16N2O6 and a molecular weight of 236.22 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6S)-6-[(R)-amino(hydroxy)methyl]-2,4,5-trihydroxyoxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6S)-6-[(R)-amino(hydroxy)methyl]-2,4,5-trihydroxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 154702648 |
| Molecular Formula | C8H16N2O6 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-[(2R,3R,4R,5S,6S)-6-[(R)-amino(hydroxy)methyl]-2,4,5-trihydroxyoxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H]([C@H](N)O)O[C@H]1O |
| InChI | InChI=1S/C8H16N2O6/c1-2(11)10-3-4(12)5(13)6(7(9)14)16-8(3)15/h3-8,12-15H,9H2,1H3,(H,10,11)/t3-,4-,5+,6+,7-,8-/m1/s1 |
| InChIKey | QJHQPHNHPGTBPF-YQOPPWPCSA-N |
| XLogP | -3.79 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|