C8H12KN3O2 — CID 154702947
potassium 2-[2-(dimethylamino)ethyl]pyrazole-3-carboxylate (PubChem CID 154702947) has the molecular formula C8H12KN3O2 and a molecular weight of 221.30 g/mol. Its IUPAC name is potassium 2-[2-(dimethylamino)ethyl]pyrazole-3-carboxylate.
| Compound Name | potassium 2-[2-(dimethylamino)ethyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 154702947 |
| Molecular Formula | C8H12KN3O2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | potassium 2-[2-(dimethylamino)ethyl]pyrazole-3-carboxylate |
| SMILES | CN(C)CCn1nccc1C(=O)[O-].[K+] |
| InChI | InChI=1S/C8H13N3O2.K/c1-10(2)5-6-11-7(8(12)13)3-4-9-11;/h3-4H,5-6H2,1-2H3,(H,12,13);/q;+1/p-1 |
| InChIKey | SUIWIGTVWOJVCP-UHFFFAOYSA-M |
| XLogP | -4.19 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |