C26H31N3O2S2 — CID 154703160
4-[4-(4-naphthalen-1-ylsulfanylpiperidin-1-yl)piperidin-1-yl]benzenesulfonamide (PubChem CID 154703160) has the molecular formula C26H31N3O2S2 and a molecular weight of 481.69 g/mol. Its IUPAC name is 4-[4-(4-naphthalen-1-ylsulfanylpiperidin-1-yl)piperidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-(4-naphthalen-1-ylsulfanylpiperidin-1-yl)piperidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 154703160 |
| Molecular Formula | C26H31N3O2S2 |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 4-[4-(4-naphthalen-1-ylsulfanylpiperidin-1-yl)piperidin-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCC(N3CCC(Sc4cccc5ccccc45)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H31N3O2S2/c27-33(30,31)24-10-8-21(9-11-24)28-16-12-22(13-17-28)29-18-14-23(15-19-29)32-26-7-3-5-20-4-1-2-6-25(20)26/h1-11,22-23H,12-19H2,(H2,27,30,31) |
| InChIKey | JINWANFNXWWUOK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |