C19H17FN4O2 — CID 154703818
N-[2-[7-(1,3-benzoxazol-2-ylamino)-5-fluoro-1H-indol-3-yl]ethyl]acetamide (PubChem CID 154703818) has the molecular formula C19H17FN4O2 and a molecular weight of 352.37 g/mol. Its IUPAC name is N-[2-[7-(1,3-benzoxazol-2-ylamino)-5-fluoro-1H-indol-3-yl]ethyl]acetamide.
| Compound Name | N-[2-[7-(1,3-benzoxazol-2-ylamino)-5-fluoro-1H-indol-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 154703818 |
| Molecular Formula | C19H17FN4O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-[2-[7-(1,3-benzoxazol-2-ylamino)-5-fluoro-1H-indol-3-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1c[nH]c2c(Nc3nc4ccccc4o3)cc(F)cc12 |
| InChI | InChI=1S/C19H17FN4O2/c1-11(25)21-7-6-12-10-22-18-14(12)8-13(20)9-16(18)24-19-23-15-4-2-3-5-17(15)26-19/h2-5,8-10,22H,6-7H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | LSUGTNAATCQHFZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |