C18H21N3O3S — CID 154703940
N-pyridin-3-yl-2-[1-(3-sulfamoylphenyl)cyclopentyl]acetamide (PubChem CID 154703940) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-pyridin-3-yl-2-[1-(3-sulfamoylphenyl)cyclopentyl]acetamide.
| Compound Name | N-pyridin-3-yl-2-[1-(3-sulfamoylphenyl)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 154703940 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-pyridin-3-yl-2-[1-(3-sulfamoylphenyl)cyclopentyl]acetamide |
| SMILES | NS(=O)(=O)c1cccc(C2(CC(=O)Nc3cccnc3)CCCC2)c1 |
| InChI | InChI=1S/C18H21N3O3S/c19-25(23,24)16-7-3-5-14(11-16)18(8-1-2-9-18)12-17(22)21-15-6-4-10-20-13-15/h3-7,10-11,13H,1-2,8-9,12H2,(H,21,22)(H2,19,23,24) |
| InChIKey | UKQRTLFQKNYRPE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |