C22H45N4O9P — CID 154705140
[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl phosphate;bis(triethylazanium) (PubChem CID 154705140) has the molecular formula C22H45N4O9P and a molecular weight of 540.60 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl phosphate;bis(triethylazanium).
| Compound Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl phosphate;bis(triethylazanium) |
|---|---|
| PubChem CID | 154705140 |
| Molecular Formula | C22H45N4O9P |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl phosphate;bis(triethylazanium) |
| SMILES | CC[NH+](CC)CC.CC[NH+](CC)CC.CO[C@@H]1[C@H](O)[C@@H](COP(=O)([O-])[O-])O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N2O9P.2C6H15N/c1-19-8-7(14)5(4-20-22(16,17)18)21-9(8)12-3-2-6(13)11-10(12)15;2*1-4-7(5-2)6-3/h2-3,5,7-9,14H,4H2,1H3,(H,11,13,15)(H2,16,17,18);2*4-6H2,1-3H3/t5-,7-,8-,9-;;/m1../s1 |
| InChIKey | CFBKPEZENKPXPD-BAZBJWKESA-N |
| XLogP | -3.48 |
| TPSA | 174.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|