C26H45IO6Si — CID 154707326
methyl (3aR,6S,6aS)-2-(iodomethyl)-6a-(3-methoxycarbonylbut-3-enyl)-6-[tri(propan-2-yl)silyloxymethyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate (PubChem CID 154707326) has the molecular formula C26H45IO6Si and a molecular weight of 608.63 g/mol. Its IUPAC name is methyl (3aR,6S,6aS)-2-(iodomethyl)-6a-(3-methoxycarbonylbut-3-enyl)-6-[tri(propan-2-yl)silyloxymethyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate.
| Compound Name | methyl (3aR,6S,6aS)-2-(iodomethyl)-6a-(3-methoxycarbonylbut-3-enyl)-6-[tri(propan-2-yl)silyloxymethyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate |
|---|---|
| PubChem CID | 154707326 |
| Molecular Formula | C26H45IO6Si |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | methyl (3aR,6S,6aS)-2-(iodomethyl)-6a-(3-methoxycarbonylbut-3-enyl)-6-[tri(propan-2-yl)silyloxymethyl]-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate |
| SMILES | C=C(CC[C@@]12OC(CI)C[C@]1(C(=O)OC)CC[C@H]2CO[Si](C(C)C)(C(C)C)C(C)C)C(=O)OC |
| InChI | InChI=1S/C26H45IO6Si/c1-17(2)34(18(3)4,19(5)6)32-16-21-11-12-25(24(29)31-9)14-22(15-27)33-26(21,25)13-10-20(7)23(28)30-8/h17-19,21-22H,7,10-16H2,1-6,8-9H3/t21-,22?,25-,26-/m0/s1 |
| InChIKey | HBTAPAYMCOHHDV-QBKKSTNISA-N |
| XLogP | 6.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|