C18H28O5Si — CID 71770390
methyl (1R,3S,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-8-methyl-2-methylidene-4-oxo-5-oxatricyclo[4.2.1.03,9]nonane-3-carboxylate (PubChem CID 71770390) has the molecular formula C18H28O5Si and a molecular weight of 352.50 g/mol. Its IUPAC name is methyl (1R,3S,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-8-methyl-2-methylidene-4-oxo-5-oxatricyclo[4.2.1.03,9]nonane-3-carboxylate.
| Compound Name | methyl (1R,3S,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-8-methyl-2-methylidene-4-oxo-5-oxatricyclo[4.2.1.03,9]nonane-3-carboxylate |
|---|---|
| PubChem CID | 71770390 |
| Molecular Formula | C18H28O5Si |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | methyl (1R,3S,6S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-8-methyl-2-methylidene-4-oxo-5-oxatricyclo[4.2.1.03,9]nonane-3-carboxylate |
| SMILES | C=C1[C@H]2[C@@H]3[C@H](C[C@]2(C)O[Si](C)(C)C(C)(C)C)OC(=O)[C@]13C(=O)OC |
| InChI | InChI=1S/C18H28O5Si/c1-10-12-13-11(22-15(20)18(10,13)14(19)21-6)9-17(12,5)23-24(7,8)16(2,3)4/h11-13H,1,9H2,2-8H3/t11-,12-,13-,17-,18+/m0/s1 |
| InChIKey | SADHGXHUUNKMKA-HHDFAXHISA-N |
| XLogP | 3.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|