C19H32O5Si — CID 91865763
methyl 2-[(3aS,4S,5S,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-3a,6a-dimethyl-6-methylidene-3-oxo-4,5-dihydro-1H-cyclopenta[c]furan-5-yl]acetate (PubChem CID 91865763) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is methyl 2-[(3aS,4S,5S,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-3a,6a-dimethyl-6-methylidene-3-oxo-4,5-dihydro-1H-cyclopenta[c]furan-5-yl]acetate.
| Compound Name | methyl 2-[(3aS,4S,5S,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-3a,6a-dimethyl-6-methylidene-3-oxo-4,5-dihydro-1H-cyclopenta[c]furan-5-yl]acetate |
|---|---|
| PubChem CID | 91865763 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | methyl 2-[(3aS,4S,5S,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-3a,6a-dimethyl-6-methylidene-3-oxo-4,5-dihydro-1H-cyclopenta[c]furan-5-yl]acetate |
| SMILES | C=C1[C@H](CC(=O)OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)C(=O)OC[C@@]12C |
| InChI | InChI=1S/C19H32O5Si/c1-12-13(10-14(20)22-7)15(24-25(8,9)17(2,3)4)19(6)16(21)23-11-18(12,19)5/h13,15H,1,10-11H2,2-9H3/t13-,15-,18-,19-/m0/s1 |
| InChIKey | AEUZVUNKYVJMHU-BMIPRAEKSA-N |
| XLogP | 3.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|