C16H20N4O2 — CID 154707853
(4R,4aS,8aS)-3-(azidomethyl)-4-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine (PubChem CID 154707853) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (4R,4aS,8aS)-3-(azidomethyl)-4-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine.
| Compound Name | (4R,4aS,8aS)-3-(azidomethyl)-4-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine |
|---|---|
| PubChem CID | 154707853 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (4R,4aS,8aS)-3-(azidomethyl)-4-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine |
| SMILES | COc1ccc([C@@H]2C(CN=[N+]=[N-])=NO[C@H]3CCCC[C@H]32)cc1 |
| InChI | InChI=1S/C16H20N4O2/c1-21-12-8-6-11(7-9-12)16-13-4-2-3-5-15(13)22-19-14(16)10-18-20-17/h6-9,13,15-16H,2-5,10H2,1H3/t13-,15+,16+/m1/s1 |
| InChIKey | MFBQJHOYABGADI-KBMXLJTQSA-N |
| XLogP | 4.03 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|