C17H20N2O2 — CID 12990190
2-[(4S,4aR,8aR)-4-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazin-3-yl]acetonitrile (PubChem CID 12990190) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[(4S,4aR,8aR)-4-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazin-3-yl]acetonitrile.
| Compound Name | 2-[(4S,4aR,8aR)-4-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 12990190 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-[(4S,4aR,8aR)-4-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazin-3-yl]acetonitrile |
| SMILES | COc1ccc([C@H]2C(CC#N)=NO[C@@H]3CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C17H20N2O2/c1-20-13-8-6-12(7-9-13)17-14-4-2-3-5-16(14)21-19-15(17)10-11-18/h6-9,14,16-17H,2-5,10H2,1H3/t14-,16+,17+/m0/s1 |
| InChIKey | GVJNGKIXZQMKOO-USXIJHARSA-N |
| XLogP | 3.64 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |