C26H33N3O2 — CID 122182706
(4S,4aR,8aR)-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine (PubChem CID 122182706) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (4S,4aR,8aR)-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine.
| Compound Name | (4S,4aR,8aR)-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine |
|---|---|
| PubChem CID | 122182706 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (4S,4aR,8aR)-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,2-benzoxazine |
| SMILES | COc1ccc(N2CCN(CC3=NO[C@@H]4CCCC[C@@H]4[C@H]3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H33N3O2/c1-30-22-13-11-21(12-14-22)29-17-15-28(16-18-29)19-24-26(20-7-3-2-4-8-20)23-9-5-6-10-25(23)31-27-24/h2-4,7-8,11-14,23,25-26H,5-6,9-10,15-19H2,1H3/t23-,25+,26+/m0/s1 |
| InChIKey | ABNWMVURYILCJQ-SKBVVQJISA-N |
| XLogP | 4.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|