C20H18N2O2 — CID 154708456
methyl 1-benzyl-2-[(E)-2-phenylethenyl]imidazole-4-carboxylate (PubChem CID 154708456) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is methyl 1-benzyl-2-[(E)-2-phenylethenyl]imidazole-4-carboxylate.
| Compound Name | methyl 1-benzyl-2-[(E)-2-phenylethenyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 154708456 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | methyl 1-benzyl-2-[(E)-2-phenylethenyl]imidazole-4-carboxylate |
| SMILES | COC(=O)c1cn(Cc2ccccc2)c(/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C20H18N2O2/c1-24-20(23)18-15-22(14-17-10-6-3-7-11-17)19(21-18)13-12-16-8-4-2-5-9-16/h2-13,15H,14H2,1H3/b13-12+ |
| InChIKey | DXHJJLJIFYORGV-OUKQBFOZSA-N |
| XLogP | 3.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |