C22H20N2O4 — CID 169233543
methyl 4-[(4-methoxyphenyl)methyl]-5-oxo-6-[(E)-2-phenylethenyl]pyrazine-2-carboxylate (PubChem CID 169233543) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl 4-[(4-methoxyphenyl)methyl]-5-oxo-6-[(E)-2-phenylethenyl]pyrazine-2-carboxylate.
| Compound Name | methyl 4-[(4-methoxyphenyl)methyl]-5-oxo-6-[(E)-2-phenylethenyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 169233543 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | methyl 4-[(4-methoxyphenyl)methyl]-5-oxo-6-[(E)-2-phenylethenyl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cn(Cc2ccc(OC)cc2)c(=O)c(/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C22H20N2O4/c1-27-18-11-8-17(9-12-18)14-24-15-20(22(26)28-2)23-19(21(24)25)13-10-16-6-4-3-5-7-16/h3-13,15H,14H2,1-2H3/b13-10+ |
| InChIKey | SYCCBFHBKXYLQK-JLHYYAGUSA-N |
| XLogP | 3.26 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |