C15H13BrF6O3S — CID 154708675
[8,8,8-trifluoro-4-(trifluoromethyl)octa-4,5-dienyl] 4-bromobenzenesulfonate (PubChem CID 154708675) has the molecular formula C15H13BrF6O3S and a molecular weight of 467.23 g/mol. Its IUPAC name is [8,8,8-trifluoro-4-(trifluoromethyl)octa-4,5-dienyl] 4-bromobenzenesulfonate.
| Compound Name | [8,8,8-trifluoro-4-(trifluoromethyl)octa-4,5-dienyl] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 154708675 |
| Molecular Formula | C15H13BrF6O3S |
| Molecular Weight | 467.23 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | [8,8,8-trifluoro-4-(trifluoromethyl)octa-4,5-dienyl] 4-bromobenzenesulfonate |
| SMILES | O=S(=O)(OCCCC(=C=CCC(F)(F)F)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13BrF6O3S/c16-12-5-7-13(8-6-12)26(23,24)25-10-2-4-11(15(20,21)22)3-1-9-14(17,18)19/h1,5-8H,2,4,9-10H2 |
| InChIKey | DAFHNQRRKNMTSX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.23 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|