C13H10BrNO3S — CID 154708962
ethyl 5-(4-bromobenzoyl)-1,3-thiazole-4-carboxylate (PubChem CID 154708962) has the molecular formula C13H10BrNO3S and a molecular weight of 340.20 g/mol. Its IUPAC name is ethyl 5-(4-bromobenzoyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-(4-bromobenzoyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 154708962 |
| Molecular Formula | C13H10BrNO3S |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | ethyl 5-(4-bromobenzoyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H10BrNO3S/c1-2-18-13(17)10-12(19-7-15-10)11(16)8-3-5-9(14)6-4-8/h3-7H,2H2,1H3 |
| InChIKey | RCZFQQYBOZBQNM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |