C17H26O — CID 154709492
(1E)-1-(2,2,5,7,7-pentamethyl-1,3,5,6-tetrahydroinden-4-ylidene)propan-2-one (PubChem CID 154709492) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (1E)-1-(2,2,5,7,7-pentamethyl-1,3,5,6-tetrahydroinden-4-ylidene)propan-2-one.
| Compound Name | (1E)-1-(2,2,5,7,7-pentamethyl-1,3,5,6-tetrahydroinden-4-ylidene)propan-2-one |
|---|---|
| PubChem CID | 154709492 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (1E)-1-(2,2,5,7,7-pentamethyl-1,3,5,6-tetrahydroinden-4-ylidene)propan-2-one |
| SMILES | CC(=O)/C=C1/C2=C(CC(C)(C)C2)C(C)(C)CC1C |
| InChI | InChI=1S/C17H26O/c1-11-8-17(5,6)15-10-16(3,4)9-14(15)13(11)7-12(2)18/h7,11H,8-10H2,1-6H3/b13-7+ |
| InChIKey | CQGLGFWKUPEUFG-NTUHNPAUSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|