C38H38FNO4 — CID 154709507
[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-[3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-2-fluoroprop-1-enyl]benzoate (PubChem CID 154709507) has the molecular formula C38H38FNO4 and a molecular weight of 591.72 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-[3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-2-fluoroprop-1-enyl]benzoate.
| Compound Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-[3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-2-fluoroprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 154709507 |
| Molecular Formula | C38H38FNO4 |
| Molecular Weight | 591.72 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] 4-[3-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]-2-fluoroprop-1-enyl]benzoate |
| SMILES | CN1C(=O)[C@](C)(CC(F)=Cc2ccc(C(=O)Oc3ccc4c(c3)CC[C@@H]3[C@@H]4CC[C@]4(C)C(=O)CC[C@@H]34)cc2)c2ccccc21 |
| InChI | InChI=1S/C38H38FNO4/c1-37-19-18-29-28-15-13-27(21-25(28)12-14-30(29)31(37)16-17-34(37)41)44-35(42)24-10-8-23(9-11-24)20-26(39)22-38(2)32-6-4-5-7-33(32)40(3)36(38)43/h4-11,13,15,20-21,29-31H,12,14,16-19,22H2,1-3H3/t29-,30-,31+,37+,38-/m1/s1 |
| InChIKey | UZXLFFPJHFNIIP-FIGLWMEBSA-N |
| XLogP | 7.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.72 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|