C43H26F6N2O6 — CID 56614906
7-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]-2-methylisoindolo[5,6-f]isoindole-1,3,6,8-tetrone (PubChem CID 56614906) has the molecular formula C43H26F6N2O6 and a molecular weight of 780.68 g/mol. Its IUPAC name is 7-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]-2-methylisoindolo[5,6-f]isoindole-1,3,6,8-tetrone.
| Compound Name | 7-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]-2-methylisoindolo[5,6-f]isoindole-1,3,6,8-tetrone |
|---|---|
| PubChem CID | 56614906 |
| Molecular Formula | C43H26F6N2O6 |
| Molecular Weight | 780.68 g/mol |
| Exact Mass | 780.17 |
| IUPAC Name | 7-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]-2-methylisoindolo[5,6-f]isoindole-1,3,6,8-tetrone |
| SMILES | Cc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(-n5c(=O)c6cc7cc8c(=O)n(C)c(=O)c8cc7cc6c5=O)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C43H26F6N2O6/c1-23-3-11-29(12-4-23)56-30-13-5-26(6-14-30)41(42(44,45)46,43(47,48)49)27-7-15-31(16-8-27)57-32-17-9-28(10-18-32)51-39(54)35-21-24-19-33-34(38(53)50(2)37(33)52)20-25(24)22-36(35)40(51)55/h3-22H,1-2H3 |
| InChIKey | FCAVBGSDLBWPFR-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.68 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |