C40H18F5N3O4 — CID 102264405
3,9-bis(4-methoxyphenyl)-5,7-dioxo-6-(2,3,4,5,6-pentafluorophenyl)-6-azapentacyclo[9.7.1.02,10.04,8.015,19]nonadeca-1(19),2,4(8),9,11,13,15,17-octaene-14,16-dicarbonitrile (PubChem CID 102264405) has the molecular formula C40H18F5N3O4 and a molecular weight of 699.59 g/mol. Its IUPAC name is 3,9-bis(4-methoxyphenyl)-5,7-dioxo-6-(2,3,4,5,6-pentafluorophenyl)-6-azapentacyclo[9.7.1.02,10.04,8.015,19]nonadeca-1(19),2,4(8),9,11,13,15,17-octaene-14,16-dicarbonitrile.
| Compound Name | 3,9-bis(4-methoxyphenyl)-5,7-dioxo-6-(2,3,4,5,6-pentafluorophenyl)-6-azapentacyclo[9.7.1.02,10.04,8.015,19]nonadeca-1(19),2,4(8),9,11,13,15,17-octaene-14,16-dicarbonitrile |
|---|---|
| PubChem CID | 102264405 |
| Molecular Formula | C40H18F5N3O4 |
| Molecular Weight | 699.59 g/mol |
| Exact Mass | 699.12 |
| IUPAC Name | 3,9-bis(4-methoxyphenyl)-5,7-dioxo-6-(2,3,4,5,6-pentafluorophenyl)-6-azapentacyclo[9.7.1.02,10.04,8.015,19]nonadeca-1(19),2,4(8),9,11,13,15,17-octaene-14,16-dicarbonitrile |
| SMILES | COc1ccc(-c2c3c(c(-c4ccc(OC)cc4)c4c2-c2ccc(C#N)c5c(C#N)ccc-4c25)C(=O)N(c2c(F)c(F)c(F)c(F)c2F)C3=O)cc1 |
| InChI | InChI=1S/C40H18F5N3O4/c1-51-21-9-3-17(4-10-21)26-29-23-13-7-19(15-46)25-20(16-47)8-14-24(28(23)25)30(29)27(18-5-11-22(52-2)12-6-18)32-31(26)39(49)48(40(32)50)38-36(44)34(42)33(41)35(43)37(38)45/h3-14H,1-2H3 |
| InChIKey | XAABJEYCQBOMTA-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.59 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|