C43H39F6NO5 — CID 163553782
5-[2-[(2R)-2-(3,3-dimethylbutyl)-1,3-dioxoinden-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]isoindole-1,3-dione (PubChem CID 163553782) has the molecular formula C43H39F6NO5 and a molecular weight of 763.78 g/mol. Its IUPAC name is 5-[2-[(2R)-2-(3,3-dimethylbutyl)-1,3-dioxoinden-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 5-[2-[(2R)-2-(3,3-dimethylbutyl)-1,3-dioxoinden-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163553782 |
| Molecular Formula | C43H39F6NO5 |
| Molecular Weight | 763.78 g/mol |
| Exact Mass | 763.27 |
| IUPAC Name | 5-[2-[(2R)-2-(3,3-dimethylbutyl)-1,3-dioxoinden-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-[4-(2-methylbutan-2-yl)phenoxy]phenyl]isoindole-1,3-dione |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)[C@H](CCC(C)(C)C)C6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C43H39F6NO5/c1-7-40(5,6)24-8-14-28(15-9-24)55-29-16-12-27(13-17-29)50-37(53)31-19-11-26(23-34(31)38(50)54)41(42(44,45)46,43(47,48)49)25-10-18-30-33(22-25)36(52)32(35(30)51)20-21-39(2,3)4/h8-19,22-23,32H,7,20-21H2,1-6H3/t32-/m1/s1 |
| InChIKey | FLHRXLKTIKNPSD-JGCGQSQUSA-N |
| XLogP | 11.20 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.78 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|