C22H14F3NO3 — CID 167530571
5-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione (PubChem CID 167530571) has the molecular formula C22H14F3NO3 and a molecular weight of 397.35 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167530571 |
| Molecular Formula | C22H14F3NO3 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)N(c2ccc(C(F)(F)F)cc2)C3=O)cc1 |
| InChI | InChI=1S/C22H14F3NO3/c1-29-17-9-2-13(3-10-17)14-4-11-18-19(12-14)21(28)26(20(18)27)16-7-5-15(6-8-16)22(23,24)25/h2-12H,1H3 |
| InChIKey | ZYZANNKQWLTNMK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|