C48H34F6N2O7 — CID 139055727
2-[3-[(1R,2R)-2-[5-(1,3-dioxoisoindol-2-yl)-2-phenoxyphenyl]-1,2,3,3,4,4-hexafluorocyclobutyl]-4-phenoxyphenyl]isoindole-1,3-dione;ethoxyethane (PubChem CID 139055727) has the molecular formula C48H34F6N2O7 and a molecular weight of 864.80 g/mol. Its IUPAC name is 2-[3-[(1R,2R)-2-[5-(1,3-dioxoisoindol-2-yl)-2-phenoxyphenyl]-1,2,3,3,4,4-hexafluorocyclobutyl]-4-phenoxyphenyl]isoindole-1,3-dione;ethoxyethane.
| Compound Name | 2-[3-[(1R,2R)-2-[5-(1,3-dioxoisoindol-2-yl)-2-phenoxyphenyl]-1,2,3,3,4,4-hexafluorocyclobutyl]-4-phenoxyphenyl]isoindole-1,3-dione;ethoxyethane |
|---|---|
| PubChem CID | 139055727 |
| Molecular Formula | C48H34F6N2O7 |
| Molecular Weight | 864.80 g/mol |
| Exact Mass | 864.23 |
| IUPAC Name | 2-[3-[(1R,2R)-2-[5-(1,3-dioxoisoindol-2-yl)-2-phenoxyphenyl]-1,2,3,3,4,4-hexafluorocyclobutyl]-4-phenoxyphenyl]isoindole-1,3-dione;ethoxyethane |
| SMILES | CCOCC.O=C1c2ccccc2C(=O)N1c1ccc(Oc2ccccc2)c([C@]2(F)C(F)(F)C(F)(F)[C@@]2(F)c2cc(N3C(=O)c4ccccc4C3=O)ccc2Oc2ccccc2)c1 |
| InChI | InChI=1S/C44H24F6N2O6.C4H10O/c45-41(33-23-25(19-21-35(33)57-27-11-3-1-4-12-27)51-37(53)29-15-7-8-16-30(29)38(51)54)42(46,44(49,50)43(41,47)48)34-24-26(20-22-36(34)58-28-13-5-2-6-14-28)52-39(55)31-17-9-10-18-32(31)40(52)56;1-3-5-4-2/h1-24H;3-4H2,1-2H3/t41-,42-;/m1./s1 |
| InChIKey | UMQHSMWXWVHNAV-FSYWDRBWSA-N |
| XLogP | 11.23 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.80 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|