C43H32F6N2O6 — CID 20679342
5-[2-[2-[4-[4-tert-butyl-2-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 20679342) has the molecular formula C43H32F6N2O6 and a molecular weight of 786.73 g/mol. Its IUPAC name is 5-[2-[2-[4-[4-tert-butyl-2-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[2-[4-[4-tert-butyl-2-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 20679342 |
| Molecular Formula | C43H32F6N2O6 |
| Molecular Weight | 786.73 g/mol |
| Exact Mass | 786.22 |
| IUPAC Name | 5-[2-[2-[4-[4-tert-butyl-2-(4-methylphenoxy)phenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(Oc2cc(C(C)(C)C)ccc2Oc2ccc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)N(C)C6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C43H32F6N2O6/c1-23-6-13-28(14-7-23)57-35-22-24(40(2,3)4)10-19-34(35)56-29-15-11-27(12-16-29)51-38(54)31-18-9-26(21-33(31)39(51)55)41(42(44,45)46,43(47,48)49)25-8-17-30-32(20-25)37(53)50(5)36(30)52/h6-22H,1-5H3 |
| InChIKey | NMZUOCGHINELGA-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.73 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|