C17H36O2Si2 — CID 154709743
(1Z,5E)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)hepta-1,5-dien-4-ol (PubChem CID 154709743) has the molecular formula C17H36O2Si2 and a molecular weight of 328.65 g/mol. Its IUPAC name is (1Z,5E)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)hepta-1,5-dien-4-ol.
| Compound Name | (1Z,5E)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)hepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 154709743 |
| Molecular Formula | C17H36O2Si2 |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (1Z,5E)-1-[tert-butyl(dimethyl)silyl]oxy-2-(trimethylsilylmethyl)hepta-1,5-dien-4-ol |
| SMILES | C/C=C/C(O)C/C(=C/O[Si](C)(C)C(C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C17H36O2Si2/c1-10-11-16(18)12-15(14-20(5,6)7)13-19-21(8,9)17(2,3)4/h10-11,13,16,18H,12,14H2,1-9H3/b11-10+,15-13- |
| InChIKey | ZPJKEIWSZCJNRW-JXIMYUQQSA-N |
| XLogP | 5.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|