C15H17NO5 — CID 154710277
(4R,7S,8R)-8-hydroxy-7-methyl-8-(phenylmethoxymethyl)-2-oxa-5-azaspiro[3.4]octane-3,6-dione (PubChem CID 154710277) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is (4R,7S,8R)-8-hydroxy-7-methyl-8-(phenylmethoxymethyl)-2-oxa-5-azaspiro[3.4]octane-3,6-dione.
| Compound Name | (4R,7S,8R)-8-hydroxy-7-methyl-8-(phenylmethoxymethyl)-2-oxa-5-azaspiro[3.4]octane-3,6-dione |
|---|---|
| PubChem CID | 154710277 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (4R,7S,8R)-8-hydroxy-7-methyl-8-(phenylmethoxymethyl)-2-oxa-5-azaspiro[3.4]octane-3,6-dione |
| SMILES | C[C@@H]1C(=O)N[C@]2(COC2=O)[C@@]1(O)COCc1ccccc1 |
| InChI | InChI=1S/C15H17NO5/c1-10-12(17)16-14(8-21-13(14)18)15(10,19)9-20-7-11-5-3-2-4-6-11/h2-6,10,19H,7-9H2,1H3,(H,16,17)/t10-,14+,15-/m1/s1 |
| InChIKey | KUKLUTNHFMJQNC-WKPIXPDZSA-N |
| XLogP | -0.00 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|