C20H25NO6 — CID 58773475
tert-butyl (3R,3aR,6aS)-2,6-dioxo-3-(2-phenylmethoxyethyl)-1,3,3a,4-tetrahydrofuro[3,4-b]pyrrole-6a-carboxylate (PubChem CID 58773475) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is tert-butyl (3R,3aR,6aS)-2,6-dioxo-3-(2-phenylmethoxyethyl)-1,3,3a,4-tetrahydrofuro[3,4-b]pyrrole-6a-carboxylate.
| Compound Name | tert-butyl (3R,3aR,6aS)-2,6-dioxo-3-(2-phenylmethoxyethyl)-1,3,3a,4-tetrahydrofuro[3,4-b]pyrrole-6a-carboxylate |
|---|---|
| PubChem CID | 58773475 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | tert-butyl (3R,3aR,6aS)-2,6-dioxo-3-(2-phenylmethoxyethyl)-1,3,3a,4-tetrahydrofuro[3,4-b]pyrrole-6a-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]12NC(=O)[C@H](CCOCc3ccccc3)[C@H]1COC2=O |
| InChI | InChI=1S/C20H25NO6/c1-19(2,3)27-18(24)20-15(12-26-17(20)23)14(16(22)21-20)9-10-25-11-13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3,(H,21,22)/t14-,15-,20+/m1/s1 |
| InChIKey | ZCWRAMATRDNTGE-SXGZJXTBSA-N |
| XLogP | 1.59 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|