C14H13NO5 — CID 102360712
methyl (3aR,4R,6aR)-2,6-dioxo-4-phenyl-1,3,3a,4-tetrahydrofuro[3,4-b]pyrrole-6a-carboxylate (PubChem CID 102360712) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is methyl (3aR,4R,6aR)-2,6-dioxo-4-phenyl-1,3,3a,4-tetrahydrofuro[3,4-b]pyrrole-6a-carboxylate.
| Compound Name | methyl (3aR,4R,6aR)-2,6-dioxo-4-phenyl-1,3,3a,4-tetrahydrofuro[3,4-b]pyrrole-6a-carboxylate |
|---|---|
| PubChem CID | 102360712 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | methyl (3aR,4R,6aR)-2,6-dioxo-4-phenyl-1,3,3a,4-tetrahydrofuro[3,4-b]pyrrole-6a-carboxylate |
| SMILES | COC(=O)[C@]12NC(=O)C[C@H]1[C@H](c1ccccc1)OC2=O |
| InChI | InChI=1S/C14H13NO5/c1-19-12(17)14-9(7-10(16)15-14)11(20-13(14)18)8-5-3-2-4-6-8/h2-6,9,11H,7H2,1H3,(H,15,16)/t9-,11-,14+/m0/s1 |
| InChIKey | YRTPYNWYFWVGDO-NURSFMCSSA-N |
| XLogP | 0.33 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|