C20H27NO6 — CID 58773525
tert-butyl (2R,3aR,6R,6aS)-6-(hydroxymethyl)-6a-methyl-4-oxo-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate (PubChem CID 58773525) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is tert-butyl (2R,3aR,6R,6aS)-6-(hydroxymethyl)-6a-methyl-4-oxo-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate.
| Compound Name | tert-butyl (2R,3aR,6R,6aS)-6-(hydroxymethyl)-6a-methyl-4-oxo-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate |
|---|---|
| PubChem CID | 58773525 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | tert-butyl (2R,3aR,6R,6aS)-6-(hydroxymethyl)-6a-methyl-4-oxo-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(CO)NC(=O)[C@@H]2C[C@H](OCc3ccccc3)O[C@@]21C |
| InChI | InChI=1S/C20H27NO6/c1-18(2,3)27-17(24)20(12-22)19(4)14(16(23)21-20)10-15(26-19)25-11-13-8-6-5-7-9-13/h5-9,14-15,22H,10-12H2,1-4H3,(H,21,23)/t14-,15+,19-,20-/m0/s1 |
| InChIKey | GGYUVDUNSZVBOC-VZJWBNGJSA-N |
| XLogP | 1.53 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |