C26H35NO6 — CID 58773491
tert-butyl (2R,3aR,6R,6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6a-methyl-4-oxo-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate (PubChem CID 58773491) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is tert-butyl (2R,3aR,6R,6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6a-methyl-4-oxo-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate.
| Compound Name | tert-butyl (2R,3aR,6R,6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6a-methyl-4-oxo-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate |
|---|---|
| PubChem CID | 58773491 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | tert-butyl (2R,3aR,6R,6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6a-methyl-4-oxo-2-phenylmethoxy-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1([C@@H](O)[C@@H]2C=CCCC2)NC(=O)[C@@H]2C[C@H](OCc3ccccc3)O[C@@]21C |
| InChI | InChI=1S/C26H35NO6/c1-24(2,3)33-23(30)26(21(28)18-13-9-6-10-14-18)25(4)19(22(29)27-26)15-20(32-25)31-16-17-11-7-5-8-12-17/h5,7-9,11-13,18-21,28H,6,10,14-16H2,1-4H3,(H,27,29)/t18-,19+,20-,21+,25+,26+/m1/s1 |
| InChIKey | ICDLWBLZNLDXIQ-TWDMHQPGSA-N |
| XLogP | 3.25 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|