C26H31NO6Se — CID 58773495
2-O-benzyl 2-O'-tert-butyl (2S,3R,4R)-4-(2-hydroxyethyl)-5-oxo-3-(phenylselanylmethyl)pyrrolidine-2,2-dicarboxylate (PubChem CID 58773495) has the molecular formula C26H31NO6Se and a molecular weight of 532.50 g/mol. Its IUPAC name is 2-O-benzyl 2-O'-tert-butyl (2S,3R,4R)-4-(2-hydroxyethyl)-5-oxo-3-(phenylselanylmethyl)pyrrolidine-2,2-dicarboxylate.
| Compound Name | 2-O-benzyl 2-O'-tert-butyl (2S,3R,4R)-4-(2-hydroxyethyl)-5-oxo-3-(phenylselanylmethyl)pyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 58773495 |
| Molecular Formula | C26H31NO6Se |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 2-O-benzyl 2-O'-tert-butyl (2S,3R,4R)-4-(2-hydroxyethyl)-5-oxo-3-(phenylselanylmethyl)pyrrolidine-2,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(C(=O)OCc2ccccc2)NC(=O)[C@H](CCO)[C@H]1C[Se]c1ccccc1 |
| InChI | InChI=1S/C26H31NO6Se/c1-25(2,3)33-24(31)26(23(30)32-16-18-10-6-4-7-11-18)21(20(14-15-28)22(29)27-26)17-34-19-12-8-5-9-13-19/h4-13,20-21,28H,14-17H2,1-3H3,(H,27,29)/t20-,21-,26+/m1/s1 |
| InChIKey | HHOHTGQPAVFBKN-YPCDYVTLSA-N |
| XLogP | 2.00 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|