C15H18O3 — CID 154711149
(1S,6R)-6-methyl-2-(2-phenylethyl)-7,8-dioxabicyclo[4.2.0]oct-4-en-3-ol (PubChem CID 154711149) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1S,6R)-6-methyl-2-(2-phenylethyl)-7,8-dioxabicyclo[4.2.0]oct-4-en-3-ol.
| Compound Name | (1S,6R)-6-methyl-2-(2-phenylethyl)-7,8-dioxabicyclo[4.2.0]oct-4-en-3-ol |
|---|---|
| PubChem CID | 154711149 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (1S,6R)-6-methyl-2-(2-phenylethyl)-7,8-dioxabicyclo[4.2.0]oct-4-en-3-ol |
| SMILES | C[C@@]12C=CC(O)C(CCc3ccccc3)[C@@H]1OO2 |
| InChI | InChI=1S/C15H18O3/c1-15-10-9-13(16)12(14(15)17-18-15)8-7-11-5-3-2-4-6-11/h2-6,9-10,12-14,16H,7-8H2,1H3/t12?,13?,14-,15+/m0/s1 |
| InChIKey | CNVNCKWAJHQCRL-PFSRBDOWSA-N |
| XLogP | 2.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|