C15H24O5 — CID 154711796
[(2R,4S)-4-methoxy-6-oxonon-8-en-2-yl] (3S)-3-hydroxypent-4-enoate (PubChem CID 154711796) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is [(2R,4S)-4-methoxy-6-oxonon-8-en-2-yl] (3S)-3-hydroxypent-4-enoate.
| Compound Name | [(2R,4S)-4-methoxy-6-oxonon-8-en-2-yl] (3S)-3-hydroxypent-4-enoate |
|---|---|
| PubChem CID | 154711796 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [(2R,4S)-4-methoxy-6-oxonon-8-en-2-yl] (3S)-3-hydroxypent-4-enoate |
| SMILES | C=CCC(=O)C[C@H](C[C@@H](C)OC(=O)C[C@H](O)C=C)OC |
| InChI | InChI=1S/C15H24O5/c1-5-7-13(17)9-14(19-4)8-11(3)20-15(18)10-12(16)6-2/h5-6,11-12,14,16H,1-2,7-10H2,3-4H3/t11-,12-,14+/m1/s1 |
| InChIKey | AZAUNIZHZHOYPE-BZPMIXESSA-N |
| XLogP | 1.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|