C17H34B2O4 — CID 154712093
4,4,5,5-tetramethyl-2-[(2S,4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane (PubChem CID 154712093) has the molecular formula C17H34B2O4 and a molecular weight of 324.08 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2S,4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2S,4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154712093 |
| Molecular Formula | C17H34B2O4 |
| Molecular Weight | 324.08 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2S,4S)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-yl]-1,3,2-dioxaborolane |
| SMILES | C[C@@H](C[C@H](C)B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H34B2O4/c1-12(18-20-14(3,4)15(5,6)21-18)11-13(2)19-22-16(7,8)17(9,10)23-19/h12-13H,11H2,1-10H3/t12-,13-/m0/s1 |
| InChIKey | CRIIJLFGOPSVRV-STQMWFEESA-N |
| XLogP | 4.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.08 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|