C17H31B2F3O4 — CID 162417819
4,4,5,5-tetramethyl-2-[5,5,5-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]-1,3,2-dioxaborolane (PubChem CID 162417819) has the molecular formula C17H31B2F3O4 and a molecular weight of 378.05 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[5,5,5-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[5,5,5-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162417819 |
| Molecular Formula | C17H31B2F3O4 |
| Molecular Weight | 378.05 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[5,5,5-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(CCCC(F)(F)F)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C17H31B2F3O4/c1-13(2)14(3,4)24-18(23-13)12(10-9-11-17(20,21)22)19-25-15(5,6)16(7,8)26-19/h12H,9-11H2,1-8H3 |
| InChIKey | CEXIVPDYAKTQEV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.05 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|