C15H27B2F3O4 — CID 102038730
4,4,5,5-tetramethyl-2-[3,3,3-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1,3,2-dioxaborolane (PubChem CID 102038730) has the molecular formula C15H27B2F3O4 and a molecular weight of 350.00 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3,3,3-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3,3,3-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102038730 |
| Molecular Formula | C15H27B2F3O4 |
| Molecular Weight | 350.00 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3,3,3-trifluoro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(CC(F)(F)F)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C15H27B2F3O4/c1-11(2)12(3,4)22-16(21-11)10(9-15(18,19)20)17-23-13(5,6)14(7,8)24-17/h10H,9H2,1-8H3 |
| InChIKey | HYHRUSBIARGZAC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.00 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|