C16H35BO4Si — CID 154712267
(1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol (PubChem CID 154712267) has the molecular formula C16H35BO4Si and a molecular weight of 330.35 g/mol. Its IUPAC name is (1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol.
| Compound Name | (1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 154712267 |
| Molecular Formula | C16H35BO4Si |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (1R,2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H35BO4Si/c1-12(11-19-22(9,10)14(2,3)4)13(18)17-20-15(5,6)16(7,8)21-17/h12-13,18H,11H2,1-10H3/t12-,13+/m1/s1 |
| InChIKey | FFAVOTDKLFJPFB-OLZOCXBDSA-N |
| XLogP | 3.64 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|