C19H43BO4Si2 — CID 154712269
tert-butyl-dimethyl-[(2R,3R)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-trimethylsilyloxypropoxy]silane (PubChem CID 154712269) has the molecular formula C19H43BO4Si2 and a molecular weight of 402.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,3R)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-trimethylsilyloxypropoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2R,3R)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-trimethylsilyloxypropoxy]silane |
|---|---|
| PubChem CID | 154712269 |
| Molecular Formula | C19H43BO4Si2 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,3R)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-trimethylsilyloxypropoxy]silane |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H43BO4Si2/c1-15(14-21-26(12,13)17(2,3)4)16(22-25(9,10)11)20-23-18(5,6)19(7,8)24-20/h15-16H,14H2,1-13H3/t15-,16+/m1/s1 |
| InChIKey | ZXJWNIPKZVRYCE-CVEARBPZSA-N |
| XLogP | 5.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|