C13H29BO3Si — CID 154719302
methoxy-dimethyl-[(1S)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane (PubChem CID 154719302) has the molecular formula C13H29BO3Si and a molecular weight of 272.27 g/mol. Its IUPAC name is methoxy-dimethyl-[(1S)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane.
| Compound Name | methoxy-dimethyl-[(1S)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane |
|---|---|
| PubChem CID | 154719302 |
| Molecular Formula | C13H29BO3Si |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | methoxy-dimethyl-[(1S)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]silane |
| SMILES | CO[Si](C)(C)[C@@H](B1OC(C)(C)C(C)(C)O1)C(C)C |
| InChI | InChI=1S/C13H29BO3Si/c1-10(2)11(18(8,9)15-7)14-16-12(3,4)13(5,6)17-14/h10-11H,1-9H3/t11-/m1/s1 |
| InChIKey | KOSJXVQSQQESTL-LLVKDONJSA-N |
| XLogP | 3.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|