C16H35BO4Si — CID 154718835
4-[tert-butyl(dimethyl)silyl]oxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol (PubChem CID 154718835) has the molecular formula C16H35BO4Si and a molecular weight of 330.35 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 154718835 |
| Molecular Formula | C16H35BO4Si |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol |
| SMILES | CC(O)(CCO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H35BO4Si/c1-13(2,3)22(9,10)19-12-11-16(8,18)17-20-14(4,5)15(6,7)21-17/h18H,11-12H2,1-10H3 |
| InChIKey | KBPOPLVSRDSYQP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|