C21H36B2O4 — CID 154712435
2-[(E)-1-(cyclohexen-1-yl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 154712435) has the molecular formula C21H36B2O4 and a molecular weight of 374.14 g/mol. Its IUPAC name is 2-[(E)-1-(cyclohexen-1-yl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-1-(cyclohexen-1-yl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 154712435 |
| Molecular Formula | C21H36B2O4 |
| Molecular Weight | 374.14 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 2-[(E)-1-(cyclohexen-1-yl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C/C(B1OC(C)(C)C(C)(C)O1)=C(\B1OC(C)(C)C(C)(C)O1)C1=CCCCC1 |
| InChI | InChI=1S/C21H36B2O4/c1-15(22-24-18(2,3)19(4,5)25-22)17(16-13-11-10-12-14-16)23-26-20(6,7)21(8,9)27-23/h13H,10-12,14H2,1-9H3/b17-15+ |
| InChIKey | LBGDIIWSZDOXSI-BMRADRMJSA-N |
| XLogP | 5.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.14 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|