C15H30O2Si — CID 154712681
tert-butyl-dimethyl-[[(2S,5S)-3-methyl-5-propan-2-yl-2,5-dihydrofuran-2-yl]methoxy]silane (PubChem CID 154712681) has the molecular formula C15H30O2Si and a molecular weight of 270.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S,5S)-3-methyl-5-propan-2-yl-2,5-dihydrofuran-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S,5S)-3-methyl-5-propan-2-yl-2,5-dihydrofuran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 154712681 |
| Molecular Formula | C15H30O2Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S,5S)-3-methyl-5-propan-2-yl-2,5-dihydrofuran-2-yl]methoxy]silane |
| SMILES | CC1=C[C@H](C(C)C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O2Si/c1-11(2)13-9-12(3)14(17-13)10-16-18(7,8)15(4,5)6/h9,11,13-14H,10H2,1-8H3/t13-,14-/m1/s1 |
| InChIKey | QHGLFFALTHBURX-ZIAGYGMSSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|