C20H18FNO3 — CID 154713580
(5R)-5-[(1R)-1-(3-fluorophenyl)prop-2-enyl]-2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-one (PubChem CID 154713580) has the molecular formula C20H18FNO3 and a molecular weight of 339.37 g/mol. Its IUPAC name is (5R)-5-[(1R)-1-(3-fluorophenyl)prop-2-enyl]-2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-one.
| Compound Name | (5R)-5-[(1R)-1-(3-fluorophenyl)prop-2-enyl]-2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 154713580 |
| Molecular Formula | C20H18FNO3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (5R)-5-[(1R)-1-(3-fluorophenyl)prop-2-enyl]-2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-one |
| SMILES | C=C[C@H](c1cccc(F)c1)[C@@]1(C)OC(c2ccc(OC)cc2)=NC1=O |
| InChI | InChI=1S/C20H18FNO3/c1-4-17(14-6-5-7-15(21)12-14)20(2)19(23)22-18(25-20)13-8-10-16(24-3)11-9-13/h4-12,17H,1H2,2-3H3/t17-,20-/m1/s1 |
| InChIKey | FXAIYCXKZWSRTC-YLJYHZDGSA-N |
| XLogP | 3.87 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|