C21H21NO3 — CID 154713578
(5R)-2-(4-methoxyphenyl)-5-methyl-5-[(1R)-1-(4-methylphenyl)prop-2-enyl]-1,3-oxazol-4-one (PubChem CID 154713578) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (5R)-2-(4-methoxyphenyl)-5-methyl-5-[(1R)-1-(4-methylphenyl)prop-2-enyl]-1,3-oxazol-4-one.
| Compound Name | (5R)-2-(4-methoxyphenyl)-5-methyl-5-[(1R)-1-(4-methylphenyl)prop-2-enyl]-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 154713578 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (5R)-2-(4-methoxyphenyl)-5-methyl-5-[(1R)-1-(4-methylphenyl)prop-2-enyl]-1,3-oxazol-4-one |
| SMILES | C=C[C@H](c1ccc(C)cc1)[C@@]1(C)OC(c2ccc(OC)cc2)=NC1=O |
| InChI | InChI=1S/C21H21NO3/c1-5-18(15-8-6-14(2)7-9-15)21(3)20(23)22-19(25-21)16-10-12-17(24-4)13-11-16/h5-13,18H,1H2,2-4H3/t18-,21-/m1/s1 |
| InChIKey | FCUWNXDGYKCIET-WIYYLYMNSA-N |
| XLogP | 4.04 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|