C21H21NO4 — CID 101340930
(5R)-5-[(1S)-1-(2,4-dimethoxyphenyl)prop-2-enyl]-5-methyl-2-phenyl-1,3-oxazol-4-one (PubChem CID 101340930) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (5R)-5-[(1S)-1-(2,4-dimethoxyphenyl)prop-2-enyl]-5-methyl-2-phenyl-1,3-oxazol-4-one.
| Compound Name | (5R)-5-[(1S)-1-(2,4-dimethoxyphenyl)prop-2-enyl]-5-methyl-2-phenyl-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 101340930 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (5R)-5-[(1S)-1-(2,4-dimethoxyphenyl)prop-2-enyl]-5-methyl-2-phenyl-1,3-oxazol-4-one |
| SMILES | C=C[C@@H](c1ccc(OC)cc1OC)[C@@]1(C)OC(c2ccccc2)=NC1=O |
| InChI | InChI=1S/C21H21NO4/c1-5-17(16-12-11-15(24-3)13-18(16)25-4)21(2)20(23)22-19(26-21)14-9-7-6-8-10-14/h5-13,17H,1H2,2-4H3/t17-,21+/m0/s1 |
| InChIKey | MNLDUAMIRKSHSX-LAUBAEHRSA-N |
| XLogP | 3.74 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|