About [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate
[4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate (PubChem CID 154714021) has the molecular formula C11H9F4IO2
and a molecular weight of 376.09 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate.
Molecular Properties
| Compound Name | [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate |
| PubChem CID | 154714021 |
| Molecular Formula | C11H9F4IO2 |
| Molecular Weight | 376.09 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate |
| SMILES | CC(F)C(I)C(=O)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F4IO2/c1-6(12)9(16)10(17)18-8-4-2-7(3-5-8)11(13,14)15/h2-6,9H,1H3 |
| InChIKey | LGMBEFBPZOTIHH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.09 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate?
The IUPAC name of [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate (CID 154714021) is [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate.
What is the SMILES notation for [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate?
The canonical SMILES for [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate is CC(F)C(I)C(=O)Oc1ccc(C(F)(F)F)cc1.
What is the InChIKey of [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate?
The InChIKey is LGMBEFBPZOTIHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F4IO2/c1-6(12)9(16)10(17)18-8-4-2-7(3-5-8)11(13,14)15/h2-6,9H,1H3.
What are the key properties of [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate?
[4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate has a molecular weight of 376.09 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(trifluoromethyl)phenyl] 3-fluoro-2-iodobutanoate is sourced from PubChem (CID 154714021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).