C21H16F6O3 — CID 56838966
[4-(trifluoromethyl)phenyl] (2E)-5-methyl-3-[4-(trifluoromethyl)phenoxy]hexa-2,4-dienoate (PubChem CID 56838966) has the molecular formula C21H16F6O3 and a molecular weight of 430.34 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] (2E)-5-methyl-3-[4-(trifluoromethyl)phenoxy]hexa-2,4-dienoate.
| Compound Name | [4-(trifluoromethyl)phenyl] (2E)-5-methyl-3-[4-(trifluoromethyl)phenoxy]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 56838966 |
| Molecular Formula | C21H16F6O3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] (2E)-5-methyl-3-[4-(trifluoromethyl)phenoxy]hexa-2,4-dienoate |
| SMILES | CC(C)=C/C(=C\C(=O)Oc1ccc(C(F)(F)F)cc1)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F6O3/c1-13(2)11-18(29-16-7-3-14(4-8-16)20(22,23)24)12-19(28)30-17-9-5-15(6-10-17)21(25,26)27/h3-12H,1-2H3/b18-12+ |
| InChIKey | PZTANNUMWVZBQV-LDADJPATSA-N |
| XLogP | 6.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|