C12H13F3N2O — CID 176904824
3-methyl-N'-[4-(trifluoromethyl)phenyl]but-2-enehydrazide (PubChem CID 176904824) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is 3-methyl-N'-[4-(trifluoromethyl)phenyl]but-2-enehydrazide.
| Compound Name | 3-methyl-N'-[4-(trifluoromethyl)phenyl]but-2-enehydrazide |
|---|---|
| PubChem CID | 176904824 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-methyl-N'-[4-(trifluoromethyl)phenyl]but-2-enehydrazide |
| SMILES | CC(C)=CC(=O)NNc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O/c1-8(2)7-11(18)17-16-10-5-3-9(4-6-10)12(13,14)15/h3-7,16H,1-2H3,(H,17,18) |
| InChIKey | CVUBNBJSVGQLBD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|