C23H15F6NO2 — CID 161413842
N-(4-hydroxyphenyl)-3,3-bis[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 161413842) has the molecular formula C23H15F6NO2 and a molecular weight of 451.37 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-3,3-bis[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-(4-hydroxyphenyl)-3,3-bis[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 161413842 |
| Molecular Formula | C23H15F6NO2 |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-(4-hydroxyphenyl)-3,3-bis[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C23H15F6NO2/c24-22(25,26)16-5-1-14(2-6-16)20(15-3-7-17(8-4-15)23(27,28)29)13-21(32)30-18-9-11-19(31)12-10-18/h1-13,31H,(H,30,32) |
| InChIKey | VVUZUJQQNMAVFO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|